C12H19N5OS — CID 143604889
4-(6-aminopyridazin-3-yl)-2-propan-2-ylpiperazine-1-carbothioic S-acid (PubChem CID 143604889) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-(6-aminopyridazin-3-yl)-2-propan-2-ylpiperazine-1-carbothioic S-acid.
| Compound Name | 4-(6-aminopyridazin-3-yl)-2-propan-2-ylpiperazine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 143604889 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-(6-aminopyridazin-3-yl)-2-propan-2-ylpiperazine-1-carbothioic S-acid |
| SMILES | CC(C)C1CN(c2ccc(N)nn2)CCN1C(=O)S |
| InChI | InChI=1S/C12H19N5OS/c1-8(2)9-7-16(5-6-17(9)12(18)19)11-4-3-10(13)14-15-11/h3-4,8-9H,5-7H2,1-2H3,(H2,13,14)(H,18,19) |
| InChIKey | WNUNYSOQEACPIS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|