C22H25FN6 — CID 141390749
N'-(2-fluorophenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide (PubChem CID 141390749) has the molecular formula C22H25FN6 and a molecular weight of 392.48 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-(2-fluorophenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 141390749 |
| Molecular Formula | C22H25FN6 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N'-(2-fluorophenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide |
| SMILES | CC(C)C1CN(c2cnc3ccccc3n2)CCN1/C(N)=N/c1ccccc1F |
| InChI | InChI=1S/C22H25FN6/c1-15(2)20-14-28(21-13-25-18-9-5-6-10-19(18)26-21)11-12-29(20)22(24)27-17-8-4-3-7-16(17)23/h3-10,13,15,20H,11-12,14H2,1-2H3,(H2,24,27) |
| InChIKey | NHEKHLQVYPYGFY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|