C21H24ClN7 — CID 143604545
4-(2-chloropyrimidin-4-yl)-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide (PubChem CID 143604545) has the molecular formula C21H24ClN7 and a molecular weight of 409.93 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-4-yl)-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chloropyrimidin-4-yl)-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143604545 |
| Molecular Formula | C21H24ClN7 |
| Molecular Weight | 409.93 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-(2-chloropyrimidin-4-yl)-2-propan-2-yl-N'-quinolin-5-ylpiperazine-1-carboximidamide |
| SMILES | CC(C)C1CN(c2ccnc(Cl)n2)CCN1/C(N)=N/c1cccc2ncccc12 |
| InChI | InChI=1S/C21H24ClN7/c1-14(2)18-13-28(19-8-10-25-20(22)27-19)11-12-29(18)21(23)26-17-7-3-6-16-15(17)5-4-9-24-16/h3-10,14,18H,11-13H2,1-2H3,(H2,23,26) |
| InChIKey | VUELZZVWPSYVJO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|