C23H27FN6 — CID 141390773
N'-(5-fluoro-2-methylphenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide (PubChem CID 141390773) has the molecular formula C23H27FN6 and a molecular weight of 406.51 g/mol. Its IUPAC name is N'-(5-fluoro-2-methylphenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-(5-fluoro-2-methylphenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 141390773 |
| Molecular Formula | C23H27FN6 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N'-(5-fluoro-2-methylphenyl)-2-propan-2-yl-4-quinoxalin-2-ylpiperazine-1-carboximidamide |
| SMILES | Cc1ccc(F)cc1/N=C(\N)N1CCN(c2cnc3ccccc3n2)CC1C(C)C |
| InChI | InChI=1S/C23H27FN6/c1-15(2)21-14-29(22-13-26-18-6-4-5-7-19(18)27-22)10-11-30(21)23(25)28-20-12-17(24)9-8-16(20)3/h4-9,12-13,15,21H,10-11,14H2,1-3H3,(H2,25,28) |
| InChIKey | CTRJVOQMIPFVSX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|