C25H28N6 — CID 72715390
N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-quinolin-2-ylpiperazine-1-carboximidamide (PubChem CID 72715390) has the molecular formula C25H28N6 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-quinolin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-quinolin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 72715390 |
| Molecular Formula | C25H28N6 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-quinolin-2-ylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(c2ccc3ccccc3n2)CC1C(C)C |
| InChI | InChI=1S/C25H28N6/c1-18(2)23-16-30(24-13-12-20-9-5-7-11-22(20)28-24)14-15-31(23)25(27-17-26)29-21-10-6-4-8-19(21)3/h4-13,18,23H,14-16H2,1-3H3,(H,27,29) |
| InChIKey | KBALIPNJWOZDCK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|