About 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide
4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide (PubChem CID 59690420) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide |
| PubChem CID | 59690420 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide |
| SMILES | CC(=O)N1CCN(/C(=N/c2ccccc2C)NC#N)C(C(C)C)C1 |
| InChI | InChI=1S/C18H25N5O/c1-13(2)17-11-22(15(4)24)9-10-23(17)18(20-12-19)21-16-8-6-5-7-14(16)3/h5-8,13,17H,9-11H2,1-4H3,(H,20,21) |
| InChIKey | FJNSRGWYEZCVFQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide?
The IUPAC name of 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide (CID 59690420) is 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide.
What is the SMILES notation for 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide?
The canonical SMILES for 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide is CC(=O)N1CCN(/C(=N/c2ccccc2C)NC#N)C(C(C)C)C1.
What is the InChIKey of 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide?
The InChIKey is FJNSRGWYEZCVFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O/c1-13(2)17-11-22(15(4)24)9-10-23(17)18(20-12-19)21-16-8-6-5-7-14(16)3/h5-8,13,17H,9-11H2,1-4H3,(H,20,21).
What are the key properties of 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide?
4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide has a molecular weight of 327.43 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-cyano-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide is sourced from PubChem (CID 59690420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).