C19H23FN4O2 — CID 53201691
N-(4-fluoro-2-methylphenyl)-2-(4-methyl-6-oxo-2-piperidin-1-ylpyrimidin-1-yl)acetamide (PubChem CID 53201691) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-2-(4-methyl-6-oxo-2-piperidin-1-ylpyrimidin-1-yl)acetamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-2-(4-methyl-6-oxo-2-piperidin-1-ylpyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 53201691 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-2-(4-methyl-6-oxo-2-piperidin-1-ylpyrimidin-1-yl)acetamide |
| SMILES | Cc1cc(=O)n(CC(=O)Nc2ccc(F)cc2C)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C19H23FN4O2/c1-13-10-15(20)6-7-16(13)22-17(25)12-24-18(26)11-14(2)21-19(24)23-8-4-3-5-9-23/h6-7,10-11H,3-5,8-9,12H2,1-2H3,(H,22,25) |
| InChIKey | URMQXMLNYCAHDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |