C24H27N5O2 — CID 91903937
2-[4-methyl-6-oxo-2-(4-phenylpiperazin-1-yl)pyrimidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 91903937) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[4-methyl-6-oxo-2-(4-phenylpiperazin-1-yl)pyrimidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-methyl-6-oxo-2-(4-phenylpiperazin-1-yl)pyrimidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 91903937 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[4-methyl-6-oxo-2-(4-phenylpiperazin-1-yl)pyrimidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(N3CCN(c4ccccc4)CC3)nc(C)cc2=O)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-18-8-10-20(11-9-18)26-22(30)17-29-23(31)16-19(2)25-24(29)28-14-12-27(13-15-28)21-6-4-3-5-7-21/h3-11,16H,12-15,17H2,1-2H3,(H,26,30) |
| InChIKey | FKXQFVGEOPLVBW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |