C19H21FN2O — CID 26070733
2-(4-fluorophenyl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 26070733) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 26070733 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(2-methyl-4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O/c1-14-12-17(22-10-2-3-11-22)8-9-18(14)21-19(23)13-15-4-6-16(20)7-5-15/h4-9,12H,2-3,10-11,13H2,1H3,(H,21,23) |
| InChIKey | IQHUXDMGVWGQJS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|