C21H24FN3O2 — CID 108949502
N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropanamide (PubChem CID 108949502) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 108949502 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropanamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N2CCN(c3ccc(F)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H24FN3O2/c1-15-3-8-19(16(2)13-15)23-20(26)14-21(27)25-11-9-24(10-12-25)18-6-4-17(22)5-7-18/h3-8,13H,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | SLOAQSMKVYWNRP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|