C21H26FN3O — CID 109027327
N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propanamide (PubChem CID 109027327) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 109027327 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2CCN(c3ccc(F)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26FN3O/c1-16-3-8-20(17(2)15-16)23-21(26)9-10-24-11-13-25(14-12-24)19-6-4-18(22)5-7-19/h3-8,15H,9-14H2,1-2H3,(H,23,26) |
| InChIKey | AKYVIGQOVIVAHM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |