C23H24F2N6O — CID 59690189
N-cyano-4-(5,7-difluoro-1,3-benzoxazol-2-yl)-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide (PubChem CID 59690189) has the molecular formula C23H24F2N6O and a molecular weight of 438.48 g/mol. Its IUPAC name is N-cyano-4-(5,7-difluoro-1,3-benzoxazol-2-yl)-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-4-(5,7-difluoro-1,3-benzoxazol-2-yl)-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59690189 |
| Molecular Formula | C23H24F2N6O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-cyano-4-(5,7-difluoro-1,3-benzoxazol-2-yl)-N'-(2-methylphenyl)-2-propan-2-ylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(c2nc3cc(F)cc(F)c3o2)CC1C(C)C |
| InChI | InChI=1S/C23H24F2N6O/c1-14(2)20-12-30(23-29-19-11-16(24)10-17(25)21(19)32-23)8-9-31(20)22(27-13-26)28-18-7-5-4-6-15(18)3/h4-7,10-11,14,20H,8-9,12H2,1-3H3,(H,27,28) |
| InChIKey | NNGBTQOUNDIVPO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|