C24H28F2N4O2 — CID 11305296
(2S)-3-cyclohexyl-N-[2-(4-fluoroanilino)ethyl]-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]propanamide (PubChem CID 11305296) has the molecular formula C24H28F2N4O2 and a molecular weight of 442.51 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-N-[2-(4-fluoroanilino)ethyl]-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]propanamide.
| Compound Name | (2S)-3-cyclohexyl-N-[2-(4-fluoroanilino)ethyl]-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 11305296 |
| Molecular Formula | C24H28F2N4O2 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (2S)-3-cyclohexyl-N-[2-(4-fluoroanilino)ethyl]-2-[(5-fluoro-1,3-benzoxazol-2-yl)amino]propanamide |
| SMILES | O=C(NCCNc1ccc(F)cc1)[C@H](CC1CCCCC1)Nc1nc2cc(F)ccc2o1 |
| InChI | InChI=1S/C24H28F2N4O2/c25-17-6-9-19(10-7-17)27-12-13-28-23(31)21(14-16-4-2-1-3-5-16)30-24-29-20-15-18(26)8-11-22(20)32-24/h6-11,15-16,21,27H,1-5,12-14H2,(H,28,31)(H,29,30)/t21-/m0/s1 |
| InChIKey | AFEWGFHFGCROEB-NRFANRHFSA-N |
| XLogP | 5.09 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|