C24H30ClN7O4 — CID 158529541
acetic acid;methyl 3-[[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazin-1-yl]-(cyanoamino)methylidene]amino]-2-methylbenzoate (PubChem CID 158529541) has the molecular formula C24H30ClN7O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is acetic acid;methyl 3-[[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazin-1-yl]-(cyanoamino)methylidene]amino]-2-methylbenzoate.
| Compound Name | acetic acid;methyl 3-[[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazin-1-yl]-(cyanoamino)methylidene]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 158529541 |
| Molecular Formula | C24H30ClN7O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | acetic acid;methyl 3-[[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazin-1-yl]-(cyanoamino)methylidene]amino]-2-methylbenzoate |
| SMILES | CC(=O)O.COC(=O)c1cccc(/N=C(\NC#N)N2CCN(c3ccnc(Cl)n3)CC2C(C)C)c1C |
| InChI | InChI=1S/C22H26ClN7O2.C2H4O2/c1-14(2)18-12-29(19-8-9-25-21(23)28-19)10-11-30(18)22(26-13-24)27-17-7-5-6-16(15(17)3)20(31)32-4;1-2(3)4/h5-9,14,18H,10-12H2,1-4H3,(H,26,27);1H3,(H,3,4) |
| InChIKey | CNFROBUMOCLYPE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|