C21H26ClN5O2S — CID 59689432
methyl 3-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbothioyl]amino]-2-methylbenzoate (PubChem CID 59689432) has the molecular formula C21H26ClN5O2S and a molecular weight of 447.99 g/mol. Its IUPAC name is methyl 3-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbothioyl]amino]-2-methylbenzoate.
| Compound Name | methyl 3-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbothioyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 59689432 |
| Molecular Formula | C21H26ClN5O2S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methyl 3-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbothioyl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NC(=S)N2CCN(c3ccnc(Cl)n3)CC2C(C)C)c1C |
| InChI | InChI=1S/C21H26ClN5O2S/c1-13(2)17-12-26(18-8-9-23-20(22)25-18)10-11-27(17)21(30)24-16-7-5-6-15(14(16)3)19(28)29-4/h5-9,13,17H,10-12H2,1-4H3,(H,24,30) |
| InChIKey | MIEFAPCSXUOMAK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|