C23H23ClN6S2 — CID 59690179
4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide (PubChem CID 59690179) has the molecular formula C23H23ClN6S2 and a molecular weight of 483.07 g/mol. Its IUPAC name is 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide.
| Compound Name | 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59690179 |
| Molecular Formula | C23H23ClN6S2 |
| Molecular Weight | 483.07 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-(2-chlorothieno[3,2-d]pyrimidin-4-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)C1CN(c2nc(Cl)nc3ccsc23)CCN1C(=S)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C23H23ClN6S2/c1-14(2)19-13-29(21-20-18(8-12-32-20)26-22(24)28-21)10-11-30(19)23(31)27-17-7-3-6-16-15(17)5-4-9-25-16/h3-9,12,14,19H,10-11,13H2,1-2H3,(H,27,31) |
| InChIKey | NXESQJMNAIDBIB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|