C24H31N7S — CID 86619343
2-propan-2-yl-4-[6-(propan-2-ylamino)pyridazin-3-yl]-N-quinolin-5-ylpiperazine-1-carbothioamide (PubChem CID 86619343) has the molecular formula C24H31N7S and a molecular weight of 449.63 g/mol. Its IUPAC name is 2-propan-2-yl-4-[6-(propan-2-ylamino)pyridazin-3-yl]-N-quinolin-5-ylpiperazine-1-carbothioamide.
| Compound Name | 2-propan-2-yl-4-[6-(propan-2-ylamino)pyridazin-3-yl]-N-quinolin-5-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 86619343 |
| Molecular Formula | C24H31N7S |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-propan-2-yl-4-[6-(propan-2-ylamino)pyridazin-3-yl]-N-quinolin-5-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)Nc1ccc(N2CCN(C(=S)Nc3cccc4ncccc34)C(C(C)C)C2)nn1 |
| InChI | InChI=1S/C24H31N7S/c1-16(2)21-15-30(23-11-10-22(28-29-23)26-17(3)4)13-14-31(21)24(32)27-20-9-5-8-19-18(20)7-6-12-25-19/h5-12,16-17,21H,13-15H2,1-4H3,(H,26,28)(H,27,32) |
| InChIKey | WZZPSDBRZVSBNE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|