C27H28N6S — CID 59690539
4-(5-phenylpyrazin-2-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide (PubChem CID 59690539) has the molecular formula C27H28N6S and a molecular weight of 468.63 g/mol. Its IUPAC name is 4-(5-phenylpyrazin-2-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide.
| Compound Name | 4-(5-phenylpyrazin-2-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59690539 |
| Molecular Formula | C27H28N6S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-(5-phenylpyrazin-2-yl)-2-propan-2-yl-N-quinolin-5-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)C1CN(c2cnc(-c3ccccc3)cn2)CCN1C(=S)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C27H28N6S/c1-19(2)25-18-32(26-17-29-24(16-30-26)20-8-4-3-5-9-20)14-15-33(25)27(34)31-23-12-6-11-22-21(23)10-7-13-28-22/h3-13,16-17,19,25H,14-15,18H2,1-2H3,(H,31,34) |
| InChIKey | GAEDXOYXUBFJNC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|