C24H28ClN5OS — CID 143604518
N-(4-chlorocyclohexa-1,5-dien-1-yl)-3-propan-2-yl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide (PubChem CID 143604518) has the molecular formula C24H28ClN5OS and a molecular weight of 470.04 g/mol. Its IUPAC name is N-(4-chlorocyclohexa-1,5-dien-1-yl)-3-propan-2-yl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorocyclohexa-1,5-dien-1-yl)-3-propan-2-yl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 143604518 |
| Molecular Formula | C24H28ClN5OS |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-(4-chlorocyclohexa-1,5-dien-1-yl)-3-propan-2-yl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide |
| SMILES | CC(C)C1CN(C(=O)NC2=CCC(Cl)C=C2)CCN1C(=S)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C24H28ClN5OS/c1-16(2)22-15-29(23(31)27-18-10-8-17(25)9-11-18)13-14-30(22)24(32)28-21-7-3-6-20-19(21)5-4-12-26-20/h3-8,10-12,16-17,22H,9,13-15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | NNRLLLAZWZCJBT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|