About N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide
N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide (PubChem CID 59689952) has the molecular formula C23H24FN5OS
and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide |
| PubChem CID | 59689952 |
| Molecular Formula | C23H24FN5OS |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide |
| SMILES | CC1(C)CN(C(=S)Nc2cccc3ncccc23)CCN1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H24FN5OS/c1-23(2)15-28(12-13-29(23)21(30)26-17-7-3-6-16(24)14-17)22(31)27-20-10-4-9-19-18(20)8-5-11-25-19/h3-11,14H,12-13,15H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | KKLQFORBTUNHRU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide?
The IUPAC name of N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide (CID 59689952) is N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide.
What is the SMILES notation for N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide?
The canonical SMILES for N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide is CC1(C)CN(C(=S)Nc2cccc3ncccc23)CCN1C(=O)Nc1cccc(F)c1.
What is the InChIKey of N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide?
The InChIKey is KKLQFORBTUNHRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24FN5OS/c1-23(2)15-28(12-13-29(23)21(30)26-17-7-3-6-16(24)14-17)22(31)27-20-10-4-9-19-18(20)8-5-11-25-19/h3-11,14H,12-13,15H2,1-2H3,(H,26,30)(H,27,31).
What are the key properties of N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide?
N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide has a molecular weight of 437.54 g/mol, XLogP of 4.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-2,2-dimethyl-4-(quinolin-5-ylcarbamothioyl)piperazine-1-carboxamide is sourced from PubChem (CID 59689952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).