C20H24ClN5O3 — CID 59690206
methyl 2-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbonyl]amino]benzoate (PubChem CID 59690206) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is methyl 2-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 59690206 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl 2-[[4-(2-chloropyrimidin-4-yl)-2-propan-2-ylpiperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCN(c2ccnc(Cl)n2)CC1C(C)C |
| InChI | InChI=1S/C20H24ClN5O3/c1-13(2)16-12-25(17-8-9-22-19(21)24-17)10-11-26(16)20(28)23-15-7-5-4-6-14(15)18(27)29-3/h4-9,13,16H,10-12H2,1-3H3,(H,23,28) |
| InChIKey | DDAXBQBJDWKMPA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |