C16H17FN4O — CID 67173303
[1-(6-aminopyridazin-3-yl)piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 67173303) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is [1-(6-aminopyridazin-3-yl)piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(6-aminopyridazin-3-yl)piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 67173303 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [1-(6-aminopyridazin-3-yl)piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | Nc1ccc(N2CCC(C(=O)c3ccc(F)cc3)CC2)nn1 |
| InChI | InChI=1S/C16H17FN4O/c17-13-3-1-11(2-4-13)16(22)12-7-9-21(10-8-12)15-6-5-14(18)19-20-15/h1-6,12H,7-10H2,(H2,18,19) |
| InChIKey | RRCLQQXNEKQMLD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |