C14H26N4OSi — CID 140876627
6-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]pyridazin-3-amine (PubChem CID 140876627) has the molecular formula C14H26N4OSi and a molecular weight of 294.48 g/mol. Its IUPAC name is 6-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]pyridazin-3-amine.
| Compound Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 140876627 |
| Molecular Formula | C14H26N4OSi |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 6-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]pyridazin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(c2ccc(N)nn2)C1 |
| InChI | InChI=1S/C14H26N4OSi/c1-14(2,3)20(4,5)19-11-8-9-18(10-11)13-7-6-12(15)16-17-13/h6-7,11H,8-10H2,1-5H3,(H2,15,16) |
| InChIKey | RZKVJYDJOQGKBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|