C9H15N5 — CID 25128833
4-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 25128833) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 25128833 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccnc(N)n2)CC1 |
| InChI | InChI=1S/C9H15N5/c1-13-4-6-14(7-5-13)8-2-3-11-9(10)12-8/h2-3H,4-7H2,1H3,(H2,10,11,12) |
| InChIKey | XEKHYAPKOUIALX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |