C13H23N5 — CID 112887954
N,N-diethyl-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112887954) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N,N-diethyl-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N,N-diethyl-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112887954 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N,N-diethyl-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CCN(CC)c1nccc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C13H23N5/c1-4-17(5-2)13-14-7-6-12(15-13)18-10-8-16(3)9-11-18/h6-7H,4-5,8-11H2,1-3H3 |
| InChIKey | JHPKXCHIJDGFGT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |