C18H29BrN2O3Si — CID 175120310
3-amino-5-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]benzoic acid (PubChem CID 175120310) has the molecular formula C18H29BrN2O3Si and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-amino-5-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]benzoic acid.
| Compound Name | 3-amino-5-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 175120310 |
| Molecular Formula | C18H29BrN2O3Si |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-amino-5-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxypiperidin-1-yl]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCN(c2c(N)cc(C(=O)O)cc2Br)C1 |
| InChI | InChI=1S/C18H29BrN2O3Si/c1-18(2,3)25(4,5)24-13-7-6-8-21(11-13)16-14(19)9-12(17(22)23)10-15(16)20/h9-10,13H,6-8,11,20H2,1-5H3,(H,22,23) |
| InChIKey | VFDJFLZGBKTVLL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|