C14H19N3O2 — CID 175044380
(6-piperazin-1-yl-2,3-dihydro-1H-inden-1-yl) carbamate (PubChem CID 175044380) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (6-piperazin-1-yl-2,3-dihydro-1H-inden-1-yl) carbamate.
| Compound Name | (6-piperazin-1-yl-2,3-dihydro-1H-inden-1-yl) carbamate |
|---|---|
| PubChem CID | 175044380 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (6-piperazin-1-yl-2,3-dihydro-1H-inden-1-yl) carbamate |
| SMILES | NC(=O)OC1CCc2ccc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C14H19N3O2/c15-14(18)19-13-4-2-10-1-3-11(9-12(10)13)17-7-5-16-6-8-17/h1,3,9,13,16H,2,4-8H2,(H2,15,18) |
| InChIKey | SVMIIDVKYXJSTH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |