C25H33N3O4Si — CID 67229400
5-(3-phenylmethoxypyrrolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid (PubChem CID 67229400) has the molecular formula C25H33N3O4Si and a molecular weight of 467.64 g/mol. Its IUPAC name is 5-(3-phenylmethoxypyrrolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid.
| Compound Name | 5-(3-phenylmethoxypyrrolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67229400 |
| Molecular Formula | C25H33N3O4Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 5-(3-phenylmethoxypyrrolidin-1-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2cc(N3CCC(OCc4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C25H33N3O4Si/c1-33(2,3)14-13-31-18-28-23-10-9-20(15-22(23)24(26-28)25(29)30)27-12-11-21(16-27)32-17-19-7-5-4-6-8-19/h4-10,15,21H,11-14,16-18H2,1-3H3,(H,29,30) |
| InChIKey | BLFYCDIVYSFBSN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|