C20H28F3N3O3Si — CID 67230247
5-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid (PubChem CID 67230247) has the molecular formula C20H28F3N3O3Si and a molecular weight of 443.54 g/mol. Its IUPAC name is 5-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid.
| Compound Name | 5-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67230247 |
| Molecular Formula | C20H28F3N3O3Si |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 5-[3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2cc(N3CCC(CC(F)(F)F)C3)ccc21 |
| InChI | InChI=1S/C20H28F3N3O3Si/c1-30(2,3)9-8-29-13-26-17-5-4-15(10-16(17)18(24-26)19(27)28)25-7-6-14(12-25)11-20(21,22)23/h4-5,10,14H,6-9,11-13H2,1-3H3,(H,27,28) |
| InChIKey | NZYRNTIEGKFOGS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|