C23H40N4O4Si2 — CID 90037130
1-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxylic acid (PubChem CID 90037130) has the molecular formula C23H40N4O4Si2 and a molecular weight of 492.77 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxylic acid.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 90037130 |
| Molecular Formula | C23H40N4O4Si2 |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)-6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C2CCc3c(C(=O)O)nn(COCC[Si](C)(C)C)c3C2)cn1 |
| InChI | InChI=1S/C23H40N4O4Si2/c1-32(2,3)11-9-30-16-26-15-19(14-24-26)18-7-8-20-21(13-18)27(25-22(20)23(28)29)17-31-10-12-33(4,5)6/h14-15,18H,7-13,16-17H2,1-6H3,(H,28,29) |
| InChIKey | AXWITZNPZUYMMK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|