C17H27N3O4Si — CID 90037885
5'-oxo-1-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydro-4H-indazole-6,2'-pyrrolidine]-3-carboxylic acid (PubChem CID 90037885) has the molecular formula C17H27N3O4Si and a molecular weight of 365.51 g/mol. Its IUPAC name is 5'-oxo-1-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydro-4H-indazole-6,2'-pyrrolidine]-3-carboxylic acid.
| Compound Name | 5'-oxo-1-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydro-4H-indazole-6,2'-pyrrolidine]-3-carboxylic acid |
|---|---|
| PubChem CID | 90037885 |
| Molecular Formula | C17H27N3O4Si |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 5'-oxo-1-(2-trimethylsilylethoxymethyl)spiro[5,7-dihydro-4H-indazole-6,2'-pyrrolidine]-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2c1CC1(CCC(=O)N1)CC2 |
| InChI | InChI=1S/C17H27N3O4Si/c1-25(2,3)9-8-24-11-20-13-10-17(7-5-14(21)18-17)6-4-12(13)15(19-20)16(22)23/h4-11H2,1-3H3,(H,18,21)(H,22,23) |
| InChIKey | LOSJBGQACACHEN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|