C27H39N5O3Si — CID 131742689
N-[1-(2-hydroxy-1-phenylethyl)pyrazol-4-yl]-6,6-dimethyl-1-(2-trimethylsilylethoxymethyl)-5,7-dihydro-4H-indazole-3-carboxamide (PubChem CID 131742689) has the molecular formula C27H39N5O3Si and a molecular weight of 509.73 g/mol. Its IUPAC name is N-[1-(2-hydroxy-1-phenylethyl)pyrazol-4-yl]-6,6-dimethyl-1-(2-trimethylsilylethoxymethyl)-5,7-dihydro-4H-indazole-3-carboxamide.
| Compound Name | N-[1-(2-hydroxy-1-phenylethyl)pyrazol-4-yl]-6,6-dimethyl-1-(2-trimethylsilylethoxymethyl)-5,7-dihydro-4H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 131742689 |
| Molecular Formula | C27H39N5O3Si |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | N-[1-(2-hydroxy-1-phenylethyl)pyrazol-4-yl]-6,6-dimethyl-1-(2-trimethylsilylethoxymethyl)-5,7-dihydro-4H-indazole-3-carboxamide |
| SMILES | CC1(C)CCc2c(C(=O)Nc3cnn(C(CO)c4ccccc4)c3)nn(COCC[Si](C)(C)C)c2C1 |
| InChI | InChI=1S/C27H39N5O3Si/c1-27(2)12-11-22-23(15-27)32(19-35-13-14-36(3,4)5)30-25(22)26(34)29-21-16-28-31(17-21)24(18-33)20-9-7-6-8-10-20/h6-10,16-17,24,33H,11-15,18-19H2,1-5H3,(H,29,34) |
| InChIKey | BTHWIGCXGLEIDZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|