C26H32BrN5O2Si — CID 71259799
6-bromo-N-[1-[(1S)-1-phenylpropyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide (PubChem CID 71259799) has the molecular formula C26H32BrN5O2Si and a molecular weight of 554.57 g/mol. Its IUPAC name is 6-bromo-N-[1-[(1S)-1-phenylpropyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide.
| Compound Name | 6-bromo-N-[1-[(1S)-1-phenylpropyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 71259799 |
| Molecular Formula | C26H32BrN5O2Si |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 6-bromo-N-[1-[(1S)-1-phenylpropyl]pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
| SMILES | CC[C@@H](c1ccccc1)n1cc(NC(=O)c2nn(COCC[Si](C)(C)C)c3cc(Br)ccc23)cn1 |
| InChI | InChI=1S/C26H32BrN5O2Si/c1-5-23(19-9-7-6-8-10-19)31-17-21(16-28-31)29-26(33)25-22-12-11-20(27)15-24(22)32(30-25)18-34-13-14-35(2,3)4/h6-12,15-17,23H,5,13-14,18H2,1-4H3,(H,29,33)/t23-/m0/s1 |
| InChIKey | ZMWUGWPKXRVQPK-QHCPKHFHSA-N |
| XLogP | 6.56 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|