C32H38BrN7O3Si — CID 131741405
N-[1-[(3-bromophenyl)methyl]pyrazol-4-yl]-6-[1-(oxan-2-yl)pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide (PubChem CID 131741405) has the molecular formula C32H38BrN7O3Si and a molecular weight of 676.69 g/mol. Its IUPAC name is N-[1-[(3-bromophenyl)methyl]pyrazol-4-yl]-6-[1-(oxan-2-yl)pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide.
| Compound Name | N-[1-[(3-bromophenyl)methyl]pyrazol-4-yl]-6-[1-(oxan-2-yl)pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 131741405 |
| Molecular Formula | C32H38BrN7O3Si |
| Molecular Weight | 676.69 g/mol |
| Exact Mass | 675.20 |
| IUPAC Name | N-[1-[(3-bromophenyl)methyl]pyrazol-4-yl]-6-[1-(oxan-2-yl)pyrazol-4-yl]-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)Nc2cnn(Cc3cccc(Br)c3)c2)c2ccc(-c3cnn(C4CCCCO4)c3)cc21 |
| InChI | InChI=1S/C32H38BrN7O3Si/c1-44(2,3)14-13-42-22-40-29-16-24(25-17-35-39(20-25)30-9-4-5-12-43-30)10-11-28(29)31(37-40)32(41)36-27-18-34-38(21-27)19-23-7-6-8-26(33)15-23/h6-8,10-11,15-18,20-21,30H,4-5,9,12-14,19,22H2,1-3H3,(H,36,41) |
| InChIKey | XWVVEOATCMJTAJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|