C28H44N4O5Si — CID 174172938
3-[3-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxybutoxy]propan-1-ol (PubChem CID 174172938) has the molecular formula C28H44N4O5Si and a molecular weight of 544.77 g/mol. Its IUPAC name is 3-[3-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxybutoxy]propan-1-ol.
| Compound Name | 3-[3-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxybutoxy]propan-1-ol |
|---|---|
| PubChem CID | 174172938 |
| Molecular Formula | C28H44N4O5Si |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 3-[3-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxybutoxy]propan-1-ol |
| SMILES | CC(CCOCCCO)Oc1ccc2c(c1)c(-c1cnn(COCC[Si](C)(C)C)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H44N4O5Si/c1-22(11-15-34-13-7-12-33)37-24-9-10-26-25(18-24)28(30-32(26)27-8-5-6-14-36-27)23-19-29-31(20-23)21-35-16-17-38(2,3)4/h9-10,18-20,22,27,33H,5-8,11-17,21H2,1-4H3 |
| InChIKey | VUTXGSPVGQUBSY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|