C28H44N4O5Si — CID 174203689
2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]ethoxy]ethanol (PubChem CID 174203689) has the molecular formula C28H44N4O5Si and a molecular weight of 544.77 g/mol. Its IUPAC name is 2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 174203689 |
| Molecular Formula | C28H44N4O5Si |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]ethoxy]ethanol |
| SMILES | CC(COCCOCCO)n1cc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cn1 |
| InChI | InChI=1S/C28H44N4O5Si/c1-21(20-35-16-15-34-14-12-33)31-19-22(18-29-31)27-24-17-23(37-38(5,6)28(2,3)4)10-11-25(24)32(30-27)26-9-7-8-13-36-26/h10-11,17-19,21,26,33H,7-9,12-16,20H2,1-6H3 |
| InChIKey | YWXLRSFCASBMGR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|