C31H46N4O7SSi — CID 165127131
[(2S)-2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-2-cyanopyrrol-1-yl]ethoxy]ethoxy]propyl] methanesulfonate (PubChem CID 165127131) has the molecular formula C31H46N4O7SSi and a molecular weight of 646.88 g/mol. Its IUPAC name is [(2S)-2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-2-cyanopyrrol-1-yl]ethoxy]ethoxy]propyl] methanesulfonate.
| Compound Name | [(2S)-2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-2-cyanopyrrol-1-yl]ethoxy]ethoxy]propyl] methanesulfonate |
|---|---|
| PubChem CID | 165127131 |
| Molecular Formula | C31H46N4O7SSi |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | [(2S)-2-[2-[2-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-2-cyanopyrrol-1-yl]ethoxy]ethoxy]propyl] methanesulfonate |
| SMILES | C[C@@H](COS(C)(=O)=O)OCCOCCn1cc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cc1C#N |
| InChI | InChI=1S/C31H46N4O7SSi/c1-23(22-41-43(5,36)37)39-17-16-38-15-13-34-21-24(18-25(34)20-32)30-27-19-26(42-44(6,7)31(2,3)4)11-12-28(27)35(33-30)29-10-8-9-14-40-29/h11-12,18-19,21,23,29H,8-10,13-17,22H2,1-7H3/t23-,29?/m0/s1 |
| InChIKey | TVHOHSSQYBYSCU-QASNXKAYSA-N |
| XLogP | 5.86 |
| TPSA | 126.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|