C28H43N3O7S2Si — CID 165127029
2-[3-[[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-2-yl]methoxy]propoxy]ethyl methanesulfonate (PubChem CID 165127029) has the molecular formula C28H43N3O7S2Si and a molecular weight of 625.89 g/mol. Its IUPAC name is 2-[3-[[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-2-yl]methoxy]propoxy]ethyl methanesulfonate.
| Compound Name | 2-[3-[[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-2-yl]methoxy]propoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 165127029 |
| Molecular Formula | C28H43N3O7S2Si |
| Molecular Weight | 625.89 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | 2-[3-[[5-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-2-yl]methoxy]propoxy]ethyl methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)c(-c1cnc(COCCCOCCOS(C)(=O)=O)s1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H43N3O7S2Si/c1-28(2,3)41(5,6)38-21-11-12-23-22(18-21)27(30-31(23)26-10-7-8-15-36-26)24-19-29-25(39-24)20-35-14-9-13-34-16-17-37-40(4,32)33/h11-12,18-19,26H,7-10,13-17,20H2,1-6H3 |
| InChIKey | MZVITTGRZHXGBR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.89 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|