C35H50N4O4Si — CID 174210720
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[3-(3-phenylmethoxybutoxy)propyl]imidazol-4-yl]indazol-5-yl]oxysilane (PubChem CID 174210720) has the molecular formula C35H50N4O4Si and a molecular weight of 618.90 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[3-(3-phenylmethoxybutoxy)propyl]imidazol-4-yl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[3-(3-phenylmethoxybutoxy)propyl]imidazol-4-yl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 174210720 |
| Molecular Formula | C35H50N4O4Si |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[3-(3-phenylmethoxybutoxy)propyl]imidazol-4-yl]indazol-5-yl]oxysilane |
| SMILES | CC(CCOCCCn1cnc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)c1)OCc1ccccc1 |
| InChI | InChI=1S/C35H50N4O4Si/c1-27(42-25-28-13-8-7-9-14-28)18-22-40-20-12-19-38-24-31(36-26-38)34-30-23-29(43-44(5,6)35(2,3)4)16-17-32(30)39(37-34)33-15-10-11-21-41-33/h7-9,13-14,16-17,23-24,26-27,33H,10-12,15,18-22,25H2,1-6H3 |
| InChIKey | QXOBPHXHRXPRCP-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|