C34H49N5O4Si — CID 165127450
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[3-[3-[(3S)-3-phenylmethoxybutoxy]propyl]-1,2,4-triazol-1-yl]indazol-5-yl]oxysilane (PubChem CID 165127450) has the molecular formula C34H49N5O4Si and a molecular weight of 619.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[3-[3-[(3S)-3-phenylmethoxybutoxy]propyl]-1,2,4-triazol-1-yl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[3-[3-[(3S)-3-phenylmethoxybutoxy]propyl]-1,2,4-triazol-1-yl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 165127450 |
| Molecular Formula | C34H49N5O4Si |
| Molecular Weight | 619.88 g/mol |
| Exact Mass | 619.36 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[3-[3-[(3S)-3-phenylmethoxybutoxy]propyl]-1,2,4-triazol-1-yl]indazol-5-yl]oxysilane |
| SMILES | C[C@@H](CCOCCCc1ncn(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1)OCc1ccccc1 |
| InChI | InChI=1S/C34H49N5O4Si/c1-26(42-24-27-13-8-7-9-14-27)19-22-40-20-12-15-31-35-25-38(36-31)33-29-23-28(43-44(5,6)34(2,3)4)17-18-30(29)39(37-33)32-16-10-11-21-41-32/h7-9,13-14,17-18,23,25-26,32H,10-12,15-16,19-22,24H2,1-6H3/t26-,32?/m0/s1 |
| InChIKey | VLYJHBMNCWIMEA-RNWYOQHESA-N |
| XLogP | 7.64 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.88 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|