C35H50N4O5Si — CID 174203772
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]propyl]pyrazol-4-yl]indazol-5-yl]oxysilane (PubChem CID 174203772) has the molecular formula C35H50N4O5Si and a molecular weight of 634.89 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]propyl]pyrazol-4-yl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]propyl]pyrazol-4-yl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 174203772 |
| Molecular Formula | C35H50N4O5Si |
| Molecular Weight | 634.89 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[1-[2-[2-(2-phenylmethoxyethoxy)ethoxy]propyl]pyrazol-4-yl]indazol-5-yl]oxysilane |
| SMILES | CC(Cn1cc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cn1)OCCOCCOCc1ccccc1 |
| InChI | InChI=1S/C35H50N4O5Si/c1-27(42-21-20-40-18-19-41-26-28-12-8-7-9-13-28)24-38-25-29(23-36-38)34-31-22-30(44-45(5,6)35(2,3)4)15-16-32(31)39(37-34)33-14-10-11-17-43-33/h7-9,12-13,15-16,22-23,25,27,33H,10-11,14,17-21,24,26H2,1-6H3 |
| InChIKey | NAHZODFCCYLOAB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 81.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.89 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|