C28H44N4O4Si — CID 165126955
(2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]butan-2-ol (PubChem CID 165126955) has the molecular formula C28H44N4O4Si and a molecular weight of 528.77 g/mol. Its IUPAC name is (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]butan-2-ol.
| Compound Name | (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]butan-2-ol |
|---|---|
| PubChem CID | 165126955 |
| Molecular Formula | C28H44N4O4Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]propoxy]butan-2-ol |
| SMILES | C[C@@H](O)CCOCCCn1cc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cn1 |
| InChI | InChI=1S/C28H44N4O4Si/c1-21(33)13-17-34-15-9-14-31-20-22(19-29-31)27-24-18-23(36-37(5,6)28(2,3)4)11-12-25(24)32(30-27)26-10-7-8-16-35-26/h11-12,18-21,26,33H,7-10,13-17H2,1-6H3/t21-,26?/m1/s1 |
| InChIKey | GWUDYXZCDVQCMO-OSMGYRLQSA-N |
| XLogP | 6.16 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|