C29H47N5O6SSi — CID 172817734
(2S)-4-[(3S)-3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]butoxy]-2-methylbutane-1-sulfonic acid (PubChem CID 172817734) has the molecular formula C29H47N5O6SSi and a molecular weight of 621.88 g/mol. Its IUPAC name is (2S)-4-[(3S)-3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]butoxy]-2-methylbutane-1-sulfonic acid.
| Compound Name | (2S)-4-[(3S)-3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]butoxy]-2-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 172817734 |
| Molecular Formula | C29H47N5O6SSi |
| Molecular Weight | 621.88 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | (2S)-4-[(3S)-3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]butoxy]-2-methylbutane-1-sulfonic acid |
| SMILES | C[C@@H](CCOCC[C@H](C)n1ncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1)CS(=O)(=O)O |
| InChI | InChI=1S/C29H47N5O6SSi/c1-21(20-41(35,36)37)13-16-38-17-14-22(2)34-30-19-25(31-34)28-24-18-23(40-42(6,7)29(3,4)5)11-12-26(24)33(32-28)27-10-8-9-15-39-27/h11-12,18-19,21-22,27H,8-10,13-17,20H2,1-7H3,(H,35,36,37)/t21-,22-,27?/m0/s1 |
| InChIKey | TUKUFGUZYIXENN-BTOHDXCHSA-N |
| XLogP | 6.26 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.88 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|