C30H46N4O7SSi — CID 174204080
4-[1-[6-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazin-2-yl]oxypropan-2-yloxy]-2-methylbutane-1-sulfonic acid (PubChem CID 174204080) has the molecular formula C30H46N4O7SSi and a molecular weight of 634.87 g/mol. Its IUPAC name is 4-[1-[6-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazin-2-yl]oxypropan-2-yloxy]-2-methylbutane-1-sulfonic acid.
| Compound Name | 4-[1-[6-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazin-2-yl]oxypropan-2-yloxy]-2-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 174204080 |
| Molecular Formula | C30H46N4O7SSi |
| Molecular Weight | 634.87 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 4-[1-[6-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazin-2-yl]oxypropan-2-yloxy]-2-methylbutane-1-sulfonic acid |
| SMILES | CC(CCOC(C)COc1cncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1)CS(=O)(=O)O |
| InChI | InChI=1S/C30H46N4O7SSi/c1-21(20-42(35,36)37)13-15-38-22(2)19-40-27-18-31-17-25(32-27)29-24-16-23(41-43(6,7)30(3,4)5)11-12-26(24)34(33-29)28-10-8-9-14-39-28/h11-12,16-18,21-22,28H,8-10,13-15,19-20H2,1-7H3,(H,35,36,37) |
| InChIKey | PZTBHEXMRWUMGI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|