C35H48N4O5Si — CID 174210407
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[6-[2-(3-phenylmethoxybutoxy)ethoxy]pyrazin-2-yl]indazol-5-yl]oxysilane (PubChem CID 174210407) has the molecular formula C35H48N4O5Si and a molecular weight of 632.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[6-[2-(3-phenylmethoxybutoxy)ethoxy]pyrazin-2-yl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[6-[2-(3-phenylmethoxybutoxy)ethoxy]pyrazin-2-yl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 174210407 |
| Molecular Formula | C35H48N4O5Si |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[6-[2-(3-phenylmethoxybutoxy)ethoxy]pyrazin-2-yl]indazol-5-yl]oxysilane |
| SMILES | CC(CCOCCOc1cncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1)OCc1ccccc1 |
| InChI | InChI=1S/C35H48N4O5Si/c1-26(43-25-27-12-8-7-9-13-27)17-19-40-20-21-41-32-24-36-23-30(37-32)34-29-22-28(44-45(5,6)35(2,3)4)15-16-31(29)39(38-34)33-14-10-11-18-42-33/h7-9,12-13,15-16,22-24,26,33H,10-11,14,17-21,25H2,1-6H3 |
| InChIKey | BYQVFHPRTPADOL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|