C37H51N3O5Si — CID 174203451
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[5-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]-3-pyridinyl]indazol-5-yl]oxysilane (PubChem CID 174203451) has the molecular formula C37H51N3O5Si and a molecular weight of 645.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[5-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]-3-pyridinyl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[5-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]-3-pyridinyl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 174203451 |
| Molecular Formula | C37H51N3O5Si |
| Molecular Weight | 645.92 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[5-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]-3-pyridinyl]indazol-5-yl]oxysilane |
| SMILES | CC(COCCOCCc1cncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)c1)OCc1ccccc1 |
| InChI | InChI=1S/C37H51N3O5Si/c1-28(44-27-29-12-8-7-9-13-29)26-42-21-20-41-19-17-30-22-31(25-38-24-30)36-33-23-32(45-46(5,6)37(2,3)4)15-16-34(33)40(39-36)35-14-10-11-18-43-35/h7-9,12-13,15-16,22-25,28,35H,10-11,14,17-21,26-27H2,1-6H3 |
| InChIKey | NLERTAUWWAIKSP-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.92 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|