C35H49N3O5SSi — CID 165127080
tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[2-[2-[(3R)-3-phenylmethoxybutoxy]ethoxymethyl]-1,3-thiazol-5-yl]indazol-5-yl]oxysilane (PubChem CID 165127080) has the molecular formula C35H49N3O5SSi and a molecular weight of 651.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[2-[2-[(3R)-3-phenylmethoxybutoxy]ethoxymethyl]-1,3-thiazol-5-yl]indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[2-[2-[(3R)-3-phenylmethoxybutoxy]ethoxymethyl]-1,3-thiazol-5-yl]indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 165127080 |
| Molecular Formula | C35H49N3O5SSi |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 651.32 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yl)-3-[2-[2-[(3R)-3-phenylmethoxybutoxy]ethoxymethyl]-1,3-thiazol-5-yl]indazol-5-yl]oxysilane |
| SMILES | C[C@H](CCOCCOCc1ncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)s1)OCc1ccccc1 |
| InChI | InChI=1S/C35H49N3O5SSi/c1-26(42-24-27-12-8-7-9-13-27)17-19-39-20-21-40-25-32-36-23-31(44-32)34-29-22-28(43-45(5,6)35(2,3)4)15-16-30(29)38(37-34)33-14-10-11-18-41-33/h7-9,12-13,15-16,22-23,26,33H,10-11,14,17-21,24-25H2,1-6H3/t26-,33?/m1/s1 |
| InChIKey | MLMVFQQVEXFHDD-UOQVMRJOSA-N |
| XLogP | 8.77 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|