C36H52N4O5Si — CID 174202608
tert-butyl-dimethyl-[3-[1-methyl-2-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]imidazol-4-yl]-1-(oxan-2-yl)indazol-5-yl]oxysilane (PubChem CID 174202608) has the molecular formula C36H52N4O5Si and a molecular weight of 648.92 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-[1-methyl-2-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]imidazol-4-yl]-1-(oxan-2-yl)indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[3-[1-methyl-2-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]imidazol-4-yl]-1-(oxan-2-yl)indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 174202608 |
| Molecular Formula | C36H52N4O5Si |
| Molecular Weight | 648.92 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | tert-butyl-dimethyl-[3-[1-methyl-2-[2-[2-(2-phenylmethoxypropoxy)ethoxy]ethyl]imidazol-4-yl]-1-(oxan-2-yl)indazol-5-yl]oxysilane |
| SMILES | CC(COCCOCCc1nc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cn1C)OCc1ccccc1 |
| InChI | InChI=1S/C36H52N4O5Si/c1-27(44-26-28-13-9-8-10-14-28)25-42-22-21-41-20-18-33-37-31(24-39(33)5)35-30-23-29(45-46(6,7)36(2,3)4)16-17-32(30)40(38-35)34-15-11-12-19-43-34/h8-10,13-14,16-17,23-24,27,34H,11-12,15,18-22,25-26H2,1-7H3 |
| InChIKey | RPDGVUAHLKWGPO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 81.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.92 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|