C27H43N5O4Si — CID 165127885
(2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]propoxy]butan-2-ol (PubChem CID 165127885) has the molecular formula C27H43N5O4Si and a molecular weight of 529.76 g/mol. Its IUPAC name is (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]propoxy]butan-2-ol.
| Compound Name | (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]propoxy]butan-2-ol |
|---|---|
| PubChem CID | 165127885 |
| Molecular Formula | C27H43N5O4Si |
| Molecular Weight | 529.76 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | (2R)-4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]propoxy]butan-2-ol |
| SMILES | C[C@@H](O)CCOCCCn1ncc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1 |
| InChI | InChI=1S/C27H43N5O4Si/c1-20(33)13-17-34-15-9-14-31-28-19-23(29-31)26-22-18-21(36-37(5,6)27(2,3)4)11-12-24(22)32(30-26)25-10-7-8-16-35-25/h11-12,18-20,25,33H,7-10,13-17H2,1-6H3/t20-,25?/m1/s1 |
| InChIKey | UOEGHTOPWYSUNN-VGOKPJQXSA-N |
| XLogP | 5.56 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|