C28H44N4O6SSi — CID 172858141
3-[4-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]butoxy]propane-1-sulfonic acid (PubChem CID 172858141) has the molecular formula C28H44N4O6SSi and a molecular weight of 592.84 g/mol. Its IUPAC name is 3-[4-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]butoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]butoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 172858141 |
| Molecular Formula | C28H44N4O6SSi |
| Molecular Weight | 592.84 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 3-[4-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]butoxy]propane-1-sulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)c(-c1cnn(CCCCOCCCS(=O)(=O)O)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H44N4O6SSi/c1-28(2,3)40(4,5)38-23-12-13-25-24(19-23)27(30-32(25)26-11-6-8-17-37-26)22-20-29-31(21-22)14-7-9-15-36-16-10-18-39(33,34)35/h12-13,19-21,26H,6-11,14-18H2,1-5H3,(H,33,34,35) |
| InChIKey | YZLAIOMGVPTKAX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.84 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|